1,5-Dibromo-1,1,3,3,5,5-hexafluoropentane structure
|
Common Name | 1,5-Dibromo-1,1,3,3,5,5-hexafluoropentane | ||
|---|---|---|---|---|
| CAS Number | 371-83-5 | Molecular Weight | 337.88400 | |
| Density | 1.991 g/mL at 25ºC(lit.) | Boiling Point | 152ºC | |
| Molecular Formula | C5H4Br2F6 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1,5-Dibromo-1,1,3,3,5,5-hexafluoropentane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.991 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 152ºC |
| Molecular Formula | C5H4Br2F6 |
| Molecular Weight | 337.88400 |
| Flash Point | >230 °F |
| Exact Mass | 335.85800 |
| LogP | 4.37730 |
| Index of Refraction | n20/D 1.4(lit.) |
| InChIKey | XYMBGGTVDWPIBA-UHFFFAOYSA-N |
| SMILES | FC(F)(Br)CC(F)(F)CC(F)(F)Br |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2903799090 |
|
~%
1,5-Dibromo-1,1... CAS#:371-83-5 |
| Literature: Tarrant et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 2783,2787 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2903799090 |
|---|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| MFCD00236657 |
| 1,5-dibromo-1,1,3,3,5,5-hexafluoropentane |