4-(4-HYDROXY-2-METHYL-QUINOLIN-3-YL)-BUTAN-2-ONE structure
|
Common Name | 4-(4-HYDROXY-2-METHYL-QUINOLIN-3-YL)-BUTAN-2-ONE | ||
|---|---|---|---|---|
| CAS Number | 37126-99-1 | Molecular Weight | 229.27400 | |
| Density | 1.114g/cm3 | Boiling Point | 375.9ºC at 760 mmHg | |
| Molecular Formula | C14H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.2ºC | |
| Name | 2-methyl-3-(3-oxobutyl)-1H-quinolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.114g/cm3 |
|---|---|
| Boiling Point | 375.9ºC at 760 mmHg |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.27400 |
| Flash Point | 147.2ºC |
| Exact Mass | 229.11000 |
| PSA | 49.93000 |
| LogP | 2.35810 |
| Index of Refraction | 1.542 |
| InChIKey | JJTBQQQQMUTHSW-UHFFFAOYSA-N |
| SMILES | CC(=O)CCc1c(C)[nH]c2ccccc2c1=O |
| HS Code | 2933499090 |
|---|
|
~%
4-(4-HYDROXY-2-... CAS#:37126-99-1 |
| Literature: Gjul'budagjan Nauchnye Trudy, Erevanskii Gosudarstvennyi Universitet, Seriya Khimicheskikh Nauk, 1956 , vol. 53, p. 57,59 Chem.Abstr., 1959 , p. 21962 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(4-Hydroxy-2-methyl-[3]chinolyl)-butan-2-on |
| 4-hydroxy-2-methyl-3-(3-oxobutyl)quinoline |
| 4-(4-hydroxy-2-methyl-[3]quinolyl)-butan-2-one |
| 2-methyl-3-(3-oxobutyl)quinolin-4(1h)-one |
| 4-(4-Hydroxy-2-methyl-quinolin-3-yl)-butan-2-one |