4-(2-methyl-1H-indol-3-yl)-4-phenylbutan-2-one structure
|
Common Name | 4-(2-methyl-1H-indol-3-yl)-4-phenylbutan-2-one | ||
|---|---|---|---|---|
| CAS Number | 97355-53-8 | Molecular Weight | 277.36000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(2-methyl-1H-indol-3-yl)-4-phenylbutan-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H19NO |
|---|---|
| Molecular Weight | 277.36000 |
| Exact Mass | 277.14700 |
| PSA | 32.86000 |
| LogP | 4.58730 |
| InChIKey | ICYNSXNBBGFKBX-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(c1ccccc1)c1c(C)[nH]c2ccccc12 |
|
~96%
4-(2-methyl-1H-... CAS#:97355-53-8 |
| Literature: Jafarpour, Maasoumeh; Rezaeifard, Abdolreza; Aliabadi, Marzieh Letters in Organic Chemistry, 2009 , vol. 6, # 1 p. 94 - 99 |
|
~97%
4-(2-methyl-1H-... CAS#:97355-53-8 |
| Literature: Sun, Shaohuan; Bai, Rongxian; Gu, Yanlong Chemistry - A European Journal, 2014 , vol. 20, # 2 p. 549 - 558 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 4-(2-methyl-indol-3-yl)-4-phenyl-butan-2-one |
| 4-(2-methyl-3-indolyl)-3-phenylbutan-1-one |
| 4-(2-methyl-3-indolyl)-4-phenyl-butan-2-one |
| 4-(2-methyl-1H-indol-3-yl)-4-phenyl-2-butanone |
| 4-(3-(2-methylindolyl))-4-phenyl-2-butanone |
| 4-(2-Methyl-3-indolyl)-4-phenyl-2-butanon |
| 2-Butanone,4-(2-methyl-1H-indol-3-yl)-4-phenyl |