4-Amino-3,5-dichlorophenacylbromide structure
|
Common Name | 4-Amino-3,5-dichlorophenacylbromide | ||
|---|---|---|---|---|
| CAS Number | 37148-47-3 | Molecular Weight | 282.949 | |
| Density | 1.764±0.06 g/cm3 | Boiling Point | 396.4±42.0 °C at 760 mmHg | |
| Molecular Formula | C8H6BrCl2NO | Melting Point | 140-142 ºC | |
| MSDS | N/A | Flash Point | 193.6±27.9 °C | |
| Name | 4-Amino-3,5-dichlorophenacylbromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.764±0.06 g/cm3 |
|---|---|
| Boiling Point | 396.4±42.0 °C at 760 mmHg |
| Melting Point | 140-142 ºC |
| Molecular Formula | C8H6BrCl2NO |
| Molecular Weight | 282.949 |
| Flash Point | 193.6±27.9 °C |
| Exact Mass | 280.900970 |
| PSA | 43.09000 |
| LogP | 3.39 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.644 |
| InChIKey | ATKJJUFAWYSFID-UHFFFAOYSA-N |
| SMILES | Nc1c(Cl)cc(C(=O)CBr)cc1Cl |
| Storage condition | -20°C Freezer, Under Inert Atmosphere |
| Water Solubility | Practically insoluble (0.031 g/L) (25 ºC) |
| HS Code | 2921199090 |
|---|
|
~74%
4-Amino-3,5-dic... CAS#:37148-47-3 |
| Literature: BIOCOPEA LIMITED; BANNISTER, Robin Mark Patent: WO2010/103312 A1, 2010 ; Location in patent: Page/Page column 9 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921199090 |
|---|---|
| Summary | 2921199090 other acyclic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-(4-Amino-3,5-dichlorophenyl)-2-bromoethanone |
| Ethanone, 1-(4-amino-3,5-dichlorophenyl)-2-bromo- |