4-Amino-3,5-dichloroacetophenone structure
|
Common Name | 4-Amino-3,5-dichloroacetophenone | ||
|---|---|---|---|---|
| CAS Number | 37148-48-4 | Molecular Weight | 204.053 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 351.5±42.0 °C at 760 mmHg | |
| Molecular Formula | C8H7Cl2NO | Melting Point | 162-166 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 166.4±27.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Amino-3,5-dichloroacetophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 351.5±42.0 °C at 760 mmHg |
| Melting Point | 162-166 °C(lit.) |
| Molecular Formula | C8H7Cl2NO |
| Molecular Weight | 204.053 |
| Flash Point | 166.4±27.9 °C |
| Exact Mass | 202.990463 |
| PSA | 43.09000 |
| LogP | 2.87 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.600 |
| InChIKey | JLPKZJDZXIKSCP-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc(Cl)c(N)c(Cl)c1 |
| Storage condition | Refrigerator |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2922399090 |
|
~%
4-Amino-3,5-dic... CAS#:37148-48-4 |
| Literature: Lutz et al. Journal of Organic Chemistry, 1947 , vol. 12, p. 617,680 |
|
~%
4-Amino-3,5-dic... CAS#:37148-48-4
Detail
Learn More
|
| Literature: Lutz et al. Journal of Organic Chemistry, 1947 , vol. 12, p. 617,680 |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4'-Amino-3',5'-dichloroacetophenone |
| EINECS 253-368-1 |
| MFCD00238535 |
| 1-(4-Amino-3,5-dichlorophenyl)ethanone |
| 4-Amino-3,5-dichloroacetophenone |
| 4’-Amino-3’,5’-dichloroacetophenone |