1-(4'-nitrophenyl)prop-2-yn-1-one
1-(4'-nitrophenyl)prop-2-yn-1-one structure
|
Common Name | 1-(4'-nitrophenyl)prop-2-yn-1-one | ||
|---|---|---|---|---|
| CAS Number | 37176-75-3 | Molecular Weight | 175.14100 | |
| Density | 1.316g/cm3 | Boiling Point | 333.5ºC at 760mmHg | |
| Molecular Formula | C9H5NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(4-nitrophenyl)prop-2-yn-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.316g/cm3 |
|---|---|
| Boiling Point | 333.5ºC at 760mmHg |
| Molecular Formula | C9H5NO3 |
| Molecular Weight | 175.14100 |
| Flash Point | 169.8ºC |
| Exact Mass | 175.02700 |
| PSA | 62.89000 |
| LogP | 1.93390 |
| Index of Refraction | 1.596 |
| InChIKey | ADFALBPJQDKCFO-UHFFFAOYSA-N |
| SMILES | C#CC(=O)c1ccc([N+](=O)[O-])cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2914700090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| NP-Pyo |
| 2-Propyn-1-one,1-(4-nitrophenyl) |
| (4-nitrobenzoyl)acetylene |
| 4-nitrophenyl ethynyl ketone |
| 1-(4-nitrophenyl)-2-propyn-1-one |
| 1-(4'-Nitrophenyl)prop-2-yn-1-one |
| p-Nitrophenyl-aethynyl-keton |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-(4-nitrophenyl)prop-2-yn-1-one? |
| A: The English name of 1-(4-nitrophenyl)prop-2-yn-1-one is 1-(4-nitrophenyl)prop-2-yn-1-one. |
| Q: What is the molecular weight of 1-(4-nitrophenyl)prop-2-yn-1-one? |
| A: Molecular weight of 1-(4-nitrophenyl)prop-2-yn-1-one is 175.14100. |
| Q: What is the LogP of 1-(4-nitrophenyl)prop-2-yn-1-one? |
| A: LogP of 1-(4-nitrophenyl)prop-2-yn-1-one is 1.93390. |
| Q: What is the polar surface area (PSA) of 1-(4-nitrophenyl)prop-2-yn-1-one? |
| A: Polar surface area (PSA) of 1-(4-nitrophenyl)prop-2-yn-1-one is 62.89000. |
| Q: What is the SMILES notation of 1-(4-nitrophenyl)prop-2-yn-1-one? |
| A: SMILES notation of 1-(4-nitrophenyl)prop-2-yn-1-one is C#CC(=O)c1ccc([N+](=O)[O-])cc1. |
| Q: What is the molecular formula of 1-(4-nitrophenyl)prop-2-yn-1-one? |
| A: Molecular formula of 1-(4-nitrophenyl)prop-2-yn-1-one is C9H5NO3. |
| Q: What are the upstream materials of 1-(4-nitrophenyl)prop-2-yn-1-one? |
| A: Related upstream materials(CAS) of 1-(4-nitrophenyl)prop-2-yn-1-one: 78725-73-2;555-16-8;757248-86-5;3383-43-5;100-19-6;122-04-3. |
| Q: What is the Chinese name of 37176-75-3? |
| A: Chinese name of 37176-75-3 is 37176-75-3. |
| Q: What is the boiling point of 1-(4-nitrophenyl)prop-2-yn-1-one? |
| A: Boiling point of 1-(4-nitrophenyl)prop-2-yn-1-one is 333.5ºC at 760mmHg. |
| Q: What is the InChIKey of 1-(4-nitrophenyl)prop-2-yn-1-one? |
| A: InChIKey of 1-(4-nitrophenyl)prop-2-yn-1-one is ADFALBPJQDKCFO-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |