1-(4'-nitrophenyl)prop-2-yn-1-one structure
|
Common Name | 1-(4'-nitrophenyl)prop-2-yn-1-one | ||
|---|---|---|---|---|
| CAS Number | 37176-75-3 | Molecular Weight | 175.14100 | |
| Density | 1.316g/cm3 | Boiling Point | 333.5ºC at 760mmHg | |
| Molecular Formula | C9H5NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.8ºC | |
| Name | 1-(4-nitrophenyl)prop-2-yn-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.316g/cm3 |
|---|---|
| Boiling Point | 333.5ºC at 760mmHg |
| Molecular Formula | C9H5NO3 |
| Molecular Weight | 175.14100 |
| Flash Point | 169.8ºC |
| Exact Mass | 175.02700 |
| PSA | 62.89000 |
| LogP | 1.93390 |
| Index of Refraction | 1.596 |
| InChIKey | ADFALBPJQDKCFO-UHFFFAOYSA-N |
| SMILES | C#CC(=O)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| NP-Pyo |
| 2-Propyn-1-one,1-(4-nitrophenyl) |
| (4-nitrobenzoyl)acetylene |
| 4-nitrophenyl ethynyl ketone |
| 1-(4-nitrophenyl)-2-propyn-1-one |
| 1-(4'-Nitrophenyl)prop-2-yn-1-one |
| p-Nitrophenyl-aethynyl-keton |