ethyl 4-(1,1,2,2-tetrafluoroethoxy)benzoate structure
|
Common Name | ethyl 4-(1,1,2,2-tetrafluoroethoxy)benzoate | ||
|---|---|---|---|---|
| CAS Number | 37178-69-1 | Molecular Weight | 266.18900 | |
| Density | 1.2849 | Boiling Point | 244ºC | |
| Molecular Formula | C11H10F4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 116ºC | |
| Name | ethyl 4-(1,1,2,2-tetrafluoroethoxy)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2849 |
|---|---|
| Boiling Point | 244ºC |
| Molecular Formula | C11H10F4O3 |
| Molecular Weight | 266.18900 |
| Flash Point | 116ºC |
| Exact Mass | 266.05700 |
| PSA | 35.53000 |
| LogP | 3.10000 |
| Index of Refraction | 1.44605 |
| InChIKey | DKRAOHBKQLAFRQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(OC(F)(F)C(F)F)cc1 |
| HS Code | 2918990090 |
|---|
|
~48%
ethyl 4-(1,1,2,... CAS#:37178-69-1 |
| Literature: Kamal, Ahmed; Pratap; Ramana, K.Venkata; Ramana; Babu, A.Hari Tetrahedron Letters, 2002 , vol. 43, # 41 p. 7353 - 7355 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| p-Ethoxycarbonyl-1,1,2,2-tetrafluorethylether |
| Benzoic acid,4-(1,1,2,2-tetrafluoroethoxy)-,ethyl ester |