3-N-Boc-amino-3-piperidine-propionic acid
Modify Date: 2025-08-27 17:34:35
3-N-Boc-amino-3-piperidine-propionic acid structure
|
Common Name | 3-N-Boc-amino-3-piperidine-propionic acid | ||
|---|---|---|---|---|
| CAS Number | 372144-09-7 | Molecular Weight | 272.34100 | |
| Density | 1.115g/cm3 | Boiling Point | 441ºC at 760 mmHg | |
| Molecular Formula | C13H24N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.5ºC | |
| Name | 3-N-Boc-amino-3-piperidine-propionic acid |
|---|
| Density | 1.115g/cm3 |
|---|---|
| Boiling Point | 441ºC at 760 mmHg |
| Molecular Formula | C13H24N2O4 |
| Molecular Weight | 272.34100 |
| Flash Point | 220.5ºC |
| Exact Mass | 272.17400 |
| PSA | 87.66000 |
| LogP | 2.07370 |
| Index of Refraction | 1.488 |
| InChIKey | LCYIVBQGRXYEAH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)C1CCCNC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |