acetic acid,5-methoxybenzene-1,3-diol structure
|
Common Name | acetic acid,5-methoxybenzene-1,3-diol | ||
|---|---|---|---|---|
| CAS Number | 3727-22-8 | Molecular Weight | 260.24100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | acetic acid,5-methoxybenzene-1,3-diol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H16O7 |
|---|---|
| Molecular Weight | 260.24100 |
| Exact Mass | 260.09000 |
| PSA | 124.29000 |
| LogP | 1.28820 |
| InChIKey | TYINNZDKABPRFX-UHFFFAOYSA-N |
| SMILES | CC(=O)O.CC(=O)O.COc1cc(O)cc(O)c1 |
| HS Code | 2918990090 |
|---|
|
~75%
acetic acid,5-m... CAS#:3727-22-8 |
| Literature: Marino, Joseph P.; Kieler, Karen A.; Kim, Min-Woo Tetrahedron, 2011 , vol. 67, # 5 p. 837 - 841 |
|
~%
acetic acid,5-m... CAS#:3727-22-8 |
| Literature: Herzig; Aigner Monatshefte fuer Chemie, 1900 , vol. 21, p. 444 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,3-Benzenediol,5-methoxy-,diacetate |
| 3,5-diacetoxyanisole |
| 1,3-diacetoxy-5-methoxy-benzene |
| 1,3-Diacetoxy-5-methoxy-benzol |
| Phloroglucinolmonomethylether diacetat |
| methyl diacetylphloroglucinol |
| Phloroglucin-methylaether-diacetat |