2-ethyl-2-(hydroxymethyl)-1,3-propanediyl diacrylate structure
|
Common Name | 2-ethyl-2-(hydroxymethyl)-1,3-propanediyl diacrylate | ||
|---|---|---|---|---|
| CAS Number | 37275-47-1 | Molecular Weight | 242.26800 | |
| Density | 1.094g/cm3 | Boiling Point | 358.7ºC at 760mmHg | |
| Molecular Formula | C12H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 130.3ºC | |
| Name | [2-(hydroxymethyl)-2-(prop-2-enoyloxymethyl)butyl] prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.094g/cm3 |
|---|---|
| Boiling Point | 358.7ºC at 760mmHg |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.26800 |
| Flash Point | 130.3ºC |
| Exact Mass | 242.11500 |
| PSA | 72.83000 |
| LogP | 0.83350 |
| Index of Refraction | 1.473 |
| InChIKey | TUOBEAZXHLTYLF-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCC(CC)(CO)COC(=O)C=C |
| HS Code | 2916190090 |
|---|
|
~%
Detail
|
| Literature: Bayer Aktiengesellschaft Patent: US4053504 A1, 1977 ; |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| trimethylolpropane diacrylate |
| 2-Ethyl-2-(hydroxymethyl)-1,3-propanediyl diacrylate |
| EINECS 253-435-5 |
| 2-[(acryloyloxy)methyl]-2-(hydroxymethyl)butyl acrylate |