perfluoro-1,3,5-trimethylcyclohexane structure
|
Common Name | perfluoro-1,3,5-trimethylcyclohexane | ||
|---|---|---|---|---|
| CAS Number | 374-76-5 | Molecular Weight | 450.06800 | |
| Density | 1,888 g/cm3 | Boiling Point | 125 °C | |
| Molecular Formula | C9F18 | Melting Point | -68°C | |
| MSDS | N/A | Flash Point | 125-128°C | |
| Name | perfluoro-1,3,5-trimethylcyclohexane |
|---|---|
| Synonym | More Synonyms |
| Density | 1,888 g/cm3 |
|---|---|
| Boiling Point | 125 °C |
| Melting Point | -68°C |
| Molecular Formula | C9F18 |
| Molecular Weight | 450.06800 |
| Flash Point | 125-128°C |
| Exact Mass | 449.97100 |
| LogP | 5.71770 |
| Index of Refraction | 1.2973 |
| InChIKey | MGOFOLPXKULBGG-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C1(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)C(F)(C(F)(F)F)C1(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| HS Code | 2903890090 |
| HS Code | 2903890090 |
|---|---|
| Summary | 2903890090. halogenated derivatives of cyclanic, cyclenic or cyclotherpenic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 1,1,2,3,3,4,5,5,6-nonafluoro-2,4,6-tris(trifluoromethyl)cyclohexane |
| MFCD00066614 |