2,4-dichloro-5-(chlorosulphonyl)benzoic acid structure
|
Common Name | 2,4-dichloro-5-(chlorosulphonyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 3740-18-9 | Molecular Weight | 289.52000 | |
| Density | 1.781g/cm3 | Boiling Point | 430.5ºC at 760 mmHg | |
| Molecular Formula | C7H3Cl3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.2ºC | |
| Name | 2,4-dichloro-5-chlorosulfonylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.781g/cm3 |
|---|---|
| Boiling Point | 430.5ºC at 760 mmHg |
| Molecular Formula | C7H3Cl3O4S |
| Molecular Weight | 289.52000 |
| Flash Point | 214.2ºC |
| Exact Mass | 287.88200 |
| PSA | 79.82000 |
| LogP | 3.69990 |
| Index of Refraction | 1.609 |
| InChIKey | MPUNAIYDVXJQBJ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(S(=O)(=O)Cl)c(Cl)cc1Cl |
| Storage condition | 2-8°C |
| Hazard Codes | C |
|---|---|
| HS Code | 2916399090 |
|
~74%
2,4-dichloro-5-... CAS#:3740-18-9 |
| Literature: Hrast, Martina; Turk, Samo; Sosic, Izidor; Knez, Damijan; Randall, Christopher P.; Barreteau, Helene; Contreras-Martel, Carlos; Dessen, Andrea; O'Neill, Alex J.; Mengin-Lecreulx, Dominique; Blanot, Didier; Gobec, Stanislav European Journal of Medicinal Chemistry, 2013 , vol. 66, p. 32 - 45 |
|
~56%
2,4-dichloro-5-... CAS#:3740-18-9 |
| Literature: ASTRAZENECA; NPS PHARMACEUTICALS, INC. Patent: WO2004/92135 A2, 2004 ; Location in patent: Page 30-31 ; WO 2004/092135 A2 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,4-dichloro-5-chlorosulfonyl benzoic acid |
| 2,4-Dichlor-5-carboxybenzolsulfochlorid |
| 2,4-Dichlor-5-chlorsulfonyl-benzoesaeure |