N-(4-methylphenyl)-N-[(4-methylphenyl)diazenyl]acetamide
![N-(4-methylphenyl)-N-[(4-methylphenyl)diazenyl]acetamide Structure](https://image.chemsrc.com/caspic/185/37446-22-3.png)
N-(4-methylphenyl)-N-[(4-methylphenyl)diazenyl]acetamide structure
|
Common Name | N-(4-methylphenyl)-N-[(4-methylphenyl)diazenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 37446-22-3 | Molecular Weight | 267.32600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(4-methylphenyl)-N-[(4-methylphenyl)diazenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H17N3O |
|---|---|
| Molecular Weight | 267.32600 |
| Exact Mass | 267.13700 |
| PSA | 45.03000 |
| LogP | 4.35520 |
| InChIKey | HYDDPHYTBABBGB-UHFFFAOYSA-N |
| SMILES | CC(=O)N(N=Nc1ccc(C)cc1)c1ccc(C)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
N-(4-methylphen... CAS#:37446-22-3 |
| Literature: Heusler Chemische Berichte, 1891 , vol. 24, p. 4161 |
|
~%
N-(4-methylphen... CAS#:37446-22-3 |
| Literature: Pytela, Oldrich; Pilny, Miroslav; Vecera, Miroslav Collection of Czechoslovak Chemical Communications, 1984 , vol. 49, # 5 p. 1173 - 1181 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| p-Toluoldiazo-(acet-p-toluidid) |
| 4.4'-Dimethyl-N-acetyl-diazoaminobenzol |
| 3-acetyl-1,3-di-p-tolyl-triazene |
| 1-Triazene,3-acetyl-1,3-bis(4-methylphenyl) |
| 1,3-Di-p-tolyl-3-acetyl-triazen |
| N-Acetyl-p.p'-diazoaminotoluol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of N-(4-methylphenyl)-N-[(4-methylphenyl)diazenyl]acetamide? |
| A: Molecular weight of N-(4-methylphenyl)-N-[(4-methylphenyl)diazenyl]acetamide is 267.32600. |
| Q: What is the InChIKey of N-(4-methylphenyl)-N-[(4-methylphenyl)diazenyl]acetamide? |
| A: InChIKey of N-(4-methylphenyl)-N-[(4-methylphenyl)diazenyl]acetamide is HYDDPHYTBABBGB-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N-(4-methylphenyl)-N-[(4-methylphenyl)diazenyl]acetamide? |
| A: SMILES notation of N-(4-methylphenyl)-N-[(4-methylphenyl)diazenyl]acetamide is CC(=O)N(N=Nc1ccc(C)cc1)c1ccc(C)cc1. |
| Q: What is the molecular formula of N-(4-methylphenyl)-N-[(4-methylphenyl)diazenyl]acetamide? |
| A: Molecular formula of N-(4-methylphenyl)-N-[(4-methylphenyl)diazenyl]acetamide is C16H17N3O. |
| Q: What is the Chinese name of 37446-22-3? |
| A: Chinese name of 37446-22-3 is 37446-22-3. |
| Q: What English synonyms does N-(4-methylphenyl)-N-[(4-methylphenyl)diazenyl]acetamide have? |
| A: English synonyms of N-(4-methylphenyl)-N-[(4-methylphenyl)diazenyl]acetamide: p-Toluoldiazo-(acet-p-toluidid), 4.4'-Dimethyl-N-acetyl-diazoaminobenzol, 3-acetyl-1,3-di-p-tolyl-triazene, 1-Triazene,3-acetyl-1,3-bis(4-methylphenyl), 1,3-Di-p-tolyl-3-acetyl-triazen, N-Acetyl-p.p'-diazoaminotoluol. |
| Q: What is the English name of N-(4-methylphenyl)-N-[(4-methylphenyl)diazenyl]acetamide? |
| A: The English name of N-(4-methylphenyl)-N-[(4-methylphenyl)diazenyl]acetamide is N-(4-methylphenyl)-N-[(4-methylphenyl)diazenyl]acetamide. |
| Q: What is the polar surface area (PSA) of N-(4-methylphenyl)-N-[(4-methylphenyl)diazenyl]acetamide? |
| A: Polar surface area (PSA) of N-(4-methylphenyl)-N-[(4-methylphenyl)diazenyl]acetamide is 45.03000. |
| Q: What is the CAS number of N-(4-methylphenyl)-N-[(4-methylphenyl)diazenyl]acetamide? |
| A: CAS number of N-(4-methylphenyl)-N-[(4-methylphenyl)diazenyl]acetamide is 37446-22-3. |
| Q: What is the LogP of N-(4-methylphenyl)-N-[(4-methylphenyl)diazenyl]acetamide? |
| A: LogP of N-(4-methylphenyl)-N-[(4-methylphenyl)diazenyl]acetamide is 4.35520. |