ALLO-1 structure
|
Common Name | ALLO-1 | ||
|---|---|---|---|---|
| CAS Number | 37468-32-9 | Molecular Weight | 314.77 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15ClN2O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
Use of ALLO-1ALLO-1, an autophagy receptor, is essential for autophagosome formation around paternal organelles and directly binds to the worm LC3 homologue LGG-1 through its LC3-interacting region (LIR) motif[1]. |
| Name | 1-Benzyl-3-(4-chlorophenyl)-5-methyl-2,4-imidazolidinedione |
|---|---|
| Synonym | More Synonyms |
| Description | ALLO-1, an autophagy receptor, is essential for autophagosome formation around paternal organelles and directly binds to the worm LC3 homologue LGG-1 through its LC3-interacting region (LIR) motif[1]. |
|---|---|
| Related Catalog | |
| Target |
Autophagy[1] |
| References |
| Molecular Formula | C17H15ClN2O2 |
|---|---|
| Molecular Weight | 314.77 |
| Exact Mass | 314.08200 |
| PSA | 40.62000 |
| LogP | 3.70020 |
| InChIKey | GHAJNZREWTZYQJ-UHFFFAOYSA-N |
| SMILES | CC1C(=O)N(c2ccc(Cl)cc2)C(=O)N1Cc1ccccc1 |
| Storage condition | 2-8℃ |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H317-H319-H400 |
| Precautionary Statements | P273-P280-P305 + P351 + P338 |
| RIDADR | UN 3077 9 / PGIII |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Benzyl-3-(4-carbamoylphenoxy)-pyrrolidin |
| 1-benzyl-3-(4-chloro-phenyl)-5-methyl-imidazolidine-2,4-dione |
| Benzamide,p-[(1-benzyl-3-pyrrolidinyl)oxy]-(8CI) |
| 3-(4-Chlorophenyl)-5-methyl-1-(phenylmethyl)-2,4-Imidazolidinedione |
| Benzamide,4-[[1-(phenylmethyl)-3-pyrrolidinyl]oxy] |
| 4-(1-BENZYLPYRROLIDIN-3-YLOXY)BENZAMIDE |