2,3-dibromo-1,1,1,2,3,4,4,4-octafluorobutane structure
|
Common Name | 2,3-dibromo-1,1,1,2,3,4,4,4-octafluorobutane | ||
|---|---|---|---|---|
| CAS Number | 375-26-8 | Molecular Weight | 359.83800 | |
| Density | 2.267 | Boiling Point | 96ºC | |
| Molecular Formula | C4Br2F8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 9.9ºC | |
| Name | 2,3-dibromo-1,1,1,2,3,4,4,4-octafluorobutane |
|---|---|
| Synonym | More Synonyms |
| Density | 2.267 |
|---|---|
| Boiling Point | 96ºC |
| Molecular Formula | C4Br2F8 |
| Molecular Weight | 359.83800 |
| Flash Point | 9.9ºC |
| Exact Mass | 357.82400 |
| LogP | 4.23240 |
| Index of Refraction | 1.3538 |
| InChIKey | WDEZAGXZUSQBLW-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(Br)C(F)(Br)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2903799090 |
|
~76%
2,3-dibromo-1,1... CAS#:375-26-8 |
| Literature: Morken, Peter A.; Campbell, Robert F.; Burton, Donald J. Journal of Fluorine Chemistry, 1994 , vol. 66, # 1 p. 81 - 86 |
|
~%
2,3-dibromo-1,1... CAS#:375-26-8 |
| Literature: Datta, Ashok K.; Fields, Roy; Haszeldine, Robert N. Journal of Chemical Research, Miniprint, 1980 , # 1 p. 235 - 265 |
| HS Code | 2903799090 |
|---|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2,3,5,6-TETRAMETHYLPHENYLZINC IODIDE |
| 2,3-Dibrom-octafluor-butan |
| 2,3-Dibrom-oktafluor-butan |
| 2,3-dibromo-1,1,1,2,3,4,4,4-octafluoro-butane |
| 2,3-dibromo-octafluorobutane |
| PC2484 |