Nonafluoropentanoyl chloride structure
|
Common Name | Nonafluoropentanoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 375-60-0 | Molecular Weight | 282.49200 | |
| Density | 1.673g/cm3 | Boiling Point | 66.4ºC at 760mmHg | |
| Molecular Formula | C5ClF9O | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | Nonafluoropentanoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.673g/cm3 |
|---|---|
| Boiling Point | 66.4ºC at 760mmHg |
| Molecular Formula | C5ClF9O |
| Molecular Weight | 282.49200 |
| Exact Mass | 281.94900 |
| PSA | 17.07000 |
| LogP | 3.22000 |
| Index of Refraction | 1.298 |
| InChIKey | HRBNMYUNLLWPAX-UHFFFAOYSA-N |
| SMILES | O=C(Cl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN 3265 |
| HS Code | 2915900090 |
|
~%
Nonafluoropenta... CAS#:375-60-0 |
| Literature: Journal of the American Chemical Society, , vol. 75, p. 5621 |
|
~%
Nonafluoropenta... CAS#:375-60-0 |
| Literature: Russian Journal of Organic Chemistry, , vol. 30, # 12 p. 1915 - 1919 Zhurnal Organicheskoi Khimii, , vol. 30, # 12 p. 1821 - 1824 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 2,2,3,3,4,4,5,5,5-nonafluoropentanoyl chloride |