tridecafluoroheptanoyl fluoride
tridecafluoroheptanoyl fluoride structure
|
Common Name | tridecafluoroheptanoyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 375-84-8 | Molecular Weight | 366.05200 | |
| Density | 1.68 g/cm3 | Boiling Point | 101ºC at 760 mmHg | |
| Molecular Formula | C7F14O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 29.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl fluoride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.68 g/cm3 |
|---|---|
| Boiling Point | 101ºC at 760 mmHg |
| Molecular Formula | C7F14O |
| Molecular Weight | 366.05200 |
| Flash Point | 29.5ºC |
| Exact Mass | 365.97300 |
| PSA | 17.07000 |
| LogP | 4.22130 |
| Index of Refraction | 1.267 |
| InChIKey | XLIFBQWTSCGUEB-UHFFFAOYSA-N |
| SMILES | O=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi: Irritant; |
|---|---|
| RIDADR | UN 3389 |
| HS Code | 2915900090 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| perfluoroenanthic acid fluoride |
| perfluoroheptanoyl fluoride |
| Heptanoyl fluoride,tridecafluoro |
| EINECS 206-797-3 |
| Tridecafluoroheptanoyl fluoride |
| perfluoroenanthyl fluoride |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl fluoride? |
| A: CAS number of 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl fluoride is 375-84-8. |
| Q: What is the English name of 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl fluoride? |
| A: The English name of 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl fluoride is 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl fluoride. |
| Q: What is the SMILES notation of 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl fluoride? |
| A: SMILES notation of 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl fluoride is O=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F. |
| Q: What is the molecular formula of 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl fluoride? |
| A: Molecular formula of 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl fluoride is C7F14O. |
| Q: What is the polar surface area (PSA) of 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl fluoride? |
| A: Polar surface area (PSA) of 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl fluoride is 17.07000. |
| Q: What is the boiling point of 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl fluoride? |
| A: Boiling point of 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl fluoride is 101ºC at 760 mmHg. |
| Q: What is the InChIKey of 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl fluoride? |
| A: InChIKey of 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl fluoride is XLIFBQWTSCGUEB-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl fluoride? |
| A: Molecular weight of 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl fluoride is 366.05200. |
| Q: What is the LogP of 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl fluoride? |
| A: LogP of 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl fluoride is 4.22130. |
| Q: What English synonyms does 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl fluoride have? |
| A: English synonyms of 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl fluoride: perfluoroenanthic acid fluoride, perfluoroheptanoyl fluoride, Heptanoyl fluoride,tridecafluoro, EINECS 206-797-3, Tridecafluoroheptanoyl fluoride, perfluoroenanthyl fluoride. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |