(R)-N-Boc-(4-Pyridyl)alanine structure
|
Common Name | (R)-N-Boc-(4-Pyridyl)alanine | ||
|---|---|---|---|---|
| CAS Number | 37535-58-3 | Molecular Weight | 266.293 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 454.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C13H18N2O4 | Melting Point | 225-229ºC | |
| MSDS | Chinese USA | Flash Point | 228.5±27.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of (R)-N-Boc-(4-Pyridyl)alanineBoc-D-4-Pal-OH is an alanine derivative[1]. |
| Name | Boc-D-4-pyridylalanine |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-D-4-Pal-OH is an alanine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 454.3±40.0 °C at 760 mmHg |
| Melting Point | 225-229ºC |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.293 |
| Flash Point | 228.5±27.3 °C |
| Exact Mass | 266.126648 |
| PSA | 88.52000 |
| LogP | 1.47 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.530 |
| InChIKey | FNYWDMKESUACOU-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccncc1)C(=O)O |
| Storage condition | Store at 0-5°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933399090 |
|
~%
(R)-N-Boc-(4-Py... CAS#:37535-58-3 |
| Literature: US2003/176698 A1, ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00672529 |
| BOC-D-4-PYRIDYLALA |
| N-t-butoxycarbonyl-D-3-(4-pyridyl)alanine |
| (2S)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-(4-pyridinyl)propanoic acid |
| RARECHEM BK PT 0243 |
| (R)-N-(tert-butoxycarbonyl)- |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-(4-pyridinyl)-L-alanine |
| N-(tert-butoxycarbonyl)-3-pyridin-4-yl-D-alanine |
| Boc-L-4-pyridylalanine |
| Boc-3-(4-pyridyl)-Ala-OH |
| Boc-3-(4-Pyridyl)-D-alanine |
| BOC-3-(4-PYRIDYL)-D-ALA-OH |
| N-(tert-Butoxycarbonyl)-3-pyridin-4-yl-L-alanine |
| (S)-2-(tert-butoxycarbonyl)-3-(pyridin-4-yl)propanoic acid |
| N-boc-3'-(4'-pyridyl)-D-alanine |
| (S)-2-((tert-Butoxycarbonyl)amino)-3-(pyridin-4-yl)propanoic acid |
| (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridin-4-ylpropanoic acid |
| (R)-2-((tert-Butoxycarbonyl)amino)-3-(pyridin-4-yl)propanoic acid |
| (R)-N-Boc-(4-Pyridyl)alanine |