4-amino-2,5,7-trichloro-fluoren-9-one structure
|
Common Name | 4-amino-2,5,7-trichloro-fluoren-9-one | ||
|---|---|---|---|---|
| CAS Number | 37568-13-1 | Molecular Weight | 298.55200 | |
| Density | 1.631g/cm3 | Boiling Point | 530.8ºC at 760 mmHg | |
| Molecular Formula | C13H6Cl3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.8ºC | |
| Name | 4-amino-2,5,7-trichlorofluoren-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.631g/cm3 |
|---|---|
| Boiling Point | 530.8ºC at 760 mmHg |
| Molecular Formula | C13H6Cl3NO |
| Molecular Weight | 298.55200 |
| Flash Point | 274.8ºC |
| Exact Mass | 296.95100 |
| PSA | 43.09000 |
| LogP | 5.02160 |
| Index of Refraction | 1.727 |
| InChIKey | SZWUDYFXBIRFPA-UHFFFAOYSA-N |
| SMILES | Nc1cc(Cl)cc2c1-c1c(Cl)cc(Cl)cc1C2=O |
| HS Code | 2922399090 |
|---|
|
~%
4-amino-2,5,7-t... CAS#:37568-13-1 |
| Literature: Pan,H.-L.; Fletcher,T.L. Synthesis, 1972 , p. 192 - 194 |
|
~%
4-amino-2,5,7-t... CAS#:37568-13-1 |
| Literature: Pan,H.-L.; Fletcher,T.L. Synthesis, 1972 , p. 192 - 194 |
|
~%
4-amino-2,5,7-t... CAS#:37568-13-1 |
| Literature: Pan,H.-L.; Fletcher,T.L. Synthesis, 1972 , p. 192 - 194 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 5-Amino-2,4,7-trichlorfluorenon |
| 5-amino-2,4,6-trinitro-resorcinol |
| 1,3-Benzenediol,5-amino-2,4,6-trinitro |