2-chloro-4-nitro-1-(2-phenylethenyl)benzene structure
|
Common Name | 2-chloro-4-nitro-1-(2-phenylethenyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 3757-14-0 | Molecular Weight | 259.68800 | |
| Density | 1.322g/cm3 | Boiling Point | 364.7ºC at 760 mmHg | |
| Molecular Formula | C14H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.4ºC | |
| Name | 2-chloro-4-nitro-1-[(E)-2-phenylethenyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.322g/cm3 |
|---|---|
| Boiling Point | 364.7ºC at 760 mmHg |
| Molecular Formula | C14H10ClNO2 |
| Molecular Weight | 259.68800 |
| Flash Point | 174.4ºC |
| Exact Mass | 259.04000 |
| PSA | 45.82000 |
| LogP | 4.94180 |
| Index of Refraction | 1.69 |
| InChIKey | RFKTYVQHFLKPRD-VOTSOKGWSA-N |
| SMILES | O=[N+]([O-])c1ccc(C=Cc2ccccc2)c(Cl)c1 |
| HS Code | 2904909090 |
|---|
|
~%
2-chloro-4-nitr... CAS#:3757-14-0 |
| Literature: Chardonnens; Heinrich Helvetica Chimica Acta, 1940 , vol. 23, p. 292,298 |
|
~%
2-chloro-4-nitr... CAS#:3757-14-0 |
| Literature: Chardonnens; Heinrich Helvetica Chimica Acta, 1940 , vol. 23, p. 292,298 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-chloro-4-nitro-stilbene |
| 2-Chlor-4-nitro-stilben |