CNT structure
|
Common Name | CNT | ||
|---|---|---|---|---|
| CAS Number | 121-86-8 | Molecular Weight | 171.581 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 256.8±20.0 °C at 760 mmHg | |
| Molecular Formula | C7H6ClNO2 | Melting Point | 61 °C | |
| MSDS | Chinese USA | Flash Point | 109.1±21.8 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Chloro-4-nitrotoluene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 256.8±20.0 °C at 760 mmHg |
| Melting Point | 61 °C |
| Molecular Formula | C7H6ClNO2 |
| Molecular Weight | 171.581 |
| Flash Point | 109.1±21.8 °C |
| Exact Mass | 171.008713 |
| PSA | 45.82000 |
| LogP | 3.10 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.570 |
| InChIKey | LLYXJBROWQDVMI-UHFFFAOYSA-N |
| SMILES | Cc1ccc([N+](=O)[O-])cc1Cl |
| Water Solubility | 49 mg/L (20 ºC) |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S36/37/39-S26-S61 |
| RIDADR | UN 3457 6.1/PG 3 |
| WGK Germany | 2 |
| RTECS | XS9100000 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2904909090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
[Method of determining p-nitrotoluene, 2-chloro-4-nitrotoluene and 3-chloro-4-methylaniline in the air].
Gig. Tr. Prof. Zabol. (1) , 43-4, (1980)
|
|
|
Two-dimensional fluorometry coupled with artificial neural networks: a novel method for on-line monitoring of complex biological processes.
Biotechnol. Bioeng. 72(3) , 297-306, (2001) The use of two-dimensional scanning fluorometry as an on-line, noninvasive, in situ bioreactor monitoring technique is extended to complex bioprocesses using mixed cultures, with particular attention ... |
|
|
An improved method for two-dimensional fluorescence monitoring of complex bioreactors.
J. Biotechnol. 128(4) , 801-12, (2007) An improved method for deconvoluting complex spectral maps from bidimensional fluorescence monitoring is presented, relying on a combination of principal component analysis (PCA) and feedforward artif... |
| cnt[qr] |
| 2-Chlor-4-nitrotoluol |
| 3-chloro-4-methyl-nitrobenzene |
| 2-chloro-4-nitro-toluene |
| CNT |
| 2-Chloro-5-nitrotoluene |
| Benzene, 2-chloro-1-methyl-4-nitro- |
| Ambap7479 |
| EINECS 204-501-7 |
| 2,4-Chloronitrotoluene |
| 2-Chlor-4-nitrotoluen |
| 4-methyl-3-chloronitrobenzene |
| 2-chloro-4-nitro-toluen |
| 2-Chloro-1-methyl-4-nitrobenzene |
| 2-Chloro-4-nitrotolu |
| o-Chloro-p-nitrotoluol |
| MFCD00007210 |