5h-octafluoropentanoyl chloride structure
|
Common Name | 5h-octafluoropentanoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 376-71-6 | Molecular Weight | 264.50100 | |
| Density | 1,67 g/cm3 | Boiling Point | 86 °C | |
| Molecular Formula | C5HClF8O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 9.1ºC | |
| Name | 2,2,3,3,4,4,5,5-octafluoropentanoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1,67 g/cm3 |
|---|---|
| Boiling Point | 86 °C |
| Molecular Formula | C5HClF8O |
| Molecular Weight | 264.50100 |
| Flash Point | 9.1ºC |
| Exact Mass | 263.95900 |
| PSA | 17.07000 |
| LogP | 2.92280 |
| Index of Refraction | 1.324 |
| InChIKey | GMTHNTFUIUGECX-UHFFFAOYSA-N |
| SMILES | O=C(Cl)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | 3265 |
| HS Code | 2915900090 |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 5H-Octafluor-valerylchlorid |
| 5H-Octafluoropentanoyl chloride |
| 2,2,3,3,4,4,5,5-octafluoro-pentanoyl chloride |
| 5H-Octafluorovaleroyl chloride |
| 5H-octafluoro-valeryl chloride |
| MFCD00153221 |
| 2.2.3.3.4.4.5.5-Octafluor-valeriansaeurechlorid |