2-bromo-4,4'-dichlorobutyrophenone structure
|
Common Name | 2-bromo-4,4'-dichlorobutyrophenone | ||
|---|---|---|---|---|
| CAS Number | 3760-66-5 | Molecular Weight | 295.98800 | |
| Density | 1.55g/cm3 | Boiling Point | 363.5ºC at 760mmHg | |
| Molecular Formula | C10H9BrCl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.7ºC | |
| Name | 2-bromo-4-chloro-1-(4-chlorophenyl)butan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.55g/cm3 |
|---|---|
| Boiling Point | 363.5ºC at 760mmHg |
| Molecular Formula | C10H9BrCl2O |
| Molecular Weight | 295.98800 |
| Flash Point | 173.7ºC |
| Exact Mass | 293.92100 |
| PSA | 17.07000 |
| LogP | 3.91510 |
| Index of Refraction | 1.573 |
| InChIKey | FJDWOHFEUUFTDH-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Cl)cc1)C(Br)CCCl |
| HS Code | 2914700090 |
|---|
|
~%
2-bromo-4,4'-di... CAS#:3760-66-5 |
| Literature: Bayer Aktiengesellschaft Patent: US4921528 A1, 1990 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-chlorophenyl 1-bromo-3-chloropropyl ketone |
| 2-Bromo-4,4'-dichlorobutyrophenone |
| 1-bromo-3-chloropropyl 4-chlorophenyl ketone |
| EINECS 223-176-2 |
| 2-bromo-4-chloro-1-(4-chlorophenyl)-butan-1-one |
| 4-chloro-phenyl 1-bromo-3-chloro-n-propyl ketone |