2-bromo-4-chloro-4'-fluorobutyrophenone structure
|
Common Name | 2-bromo-4-chloro-4'-fluorobutyrophenone | ||
|---|---|---|---|---|
| CAS Number | 51037-74-2 | Molecular Weight | 279.53300 | |
| Density | 1.526g/cm3 | Boiling Point | 330.8ºC at 760mmHg | |
| Molecular Formula | C10H9BrClFO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.8ºC | |
| Name | 2-bromo-4-chloro-1-(4-fluorophenyl)butan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.526g/cm3 |
|---|---|
| Boiling Point | 330.8ºC at 760mmHg |
| Molecular Formula | C10H9BrClFO |
| Molecular Weight | 279.53300 |
| Flash Point | 153.8ºC |
| Exact Mass | 277.95100 |
| PSA | 17.07000 |
| LogP | 3.40080 |
| Index of Refraction | 1.547 |
| InChIKey | LTDBFRKGDVLQLR-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(F)cc1)C(Br)CCCl |
| HS Code | 2914700090 |
|---|
|
~82%
2-bromo-4-chlor... CAS#:51037-74-2 |
| Literature: Cascio; Erba; Manghisi; Biazzi; Ferni; Fregnan Farmaco, Edizione Scientifica, 1980 , vol. 35, # 7 p. 605 - 614 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| EINECS 256-932-5 |
| 2-Bromo-4-chloro-4'-fluorobutyrophenone |
| 1-p-fluorobenzoyl-1-bromo-3-chloropropane |