6-(4-bromophenyl)-2,2-dimethylpiperidin-4-one structure
|
Common Name | 6-(4-bromophenyl)-2,2-dimethylpiperidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 3764-99-6 | Molecular Weight | 282.17600 | |
| Density | 1.295g/cm3 | Boiling Point | 358.9ºC at 760 mmHg | |
| Molecular Formula | C13H16BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.9ºC | |
| Name | 6-(4-bromophenyl)-2,2-dimethylpiperidin-4-one |
|---|
| Density | 1.295g/cm3 |
|---|---|
| Boiling Point | 358.9ºC at 760 mmHg |
| Molecular Formula | C13H16BrNO |
| Molecular Weight | 282.17600 |
| Flash Point | 170.9ºC |
| Exact Mass | 281.04200 |
| PSA | 29.10000 |
| LogP | 3.55010 |
| Index of Refraction | 1.536 |
| InChIKey | ASKCRCOFADPBOS-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)CC(c2ccc(Br)cc2)N1 |
| HS Code | 2933399090 |
|---|
|
~81%
6-(4-bromopheny... CAS#:3764-99-6 |
| Literature: Feng, Li-Chun; Sun, Ya-Wei; Tang, Wei-Jun; Xu, Li-Jin; Lam, Kim-Lung; Zhou, Zhongyuan; Chan, Albert S. C. Green Chemistry, 2010 , vol. 12, # 6 p. 949 - 952 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |