2,3-Dimethyl-4-nitropyridine 1-oxide structure
|
Common Name | 2,3-Dimethyl-4-nitropyridine 1-oxide | ||
|---|---|---|---|---|
| CAS Number | 37699-43-7 | Molecular Weight | 168.150 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 403.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C7H8N2O3 | Melting Point | 94-98 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 197.7±27.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Nitro-2,3-lutidine-N-oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 403.3±40.0 °C at 760 mmHg |
| Melting Point | 94-98 °C(lit.) |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.150 |
| Flash Point | 197.7±27.3 °C |
| Exact Mass | 168.053497 |
| PSA | 71.28000 |
| LogP | 0.37 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | CFMTVTYBZMKULI-UHFFFAOYSA-N |
| SMILES | Cc1c([N+](=O)[O-])cc[n+]([O-])c1C |
| Storage condition | Room temperature. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | UT2807000 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2933399090 |
|
~80%
2,3-Dimethyl-4-... CAS#:37699-43-7 |
| Literature: Tanga; Bupp; Tochimoto Journal of Heterocyclic Chemistry, 1997 , vol. 34, # 3 p. 717 - 727 |
|
~46%
2,3-Dimethyl-4-... CAS#:37699-43-7 |
| Literature: Zhang, Fang; Duan, Xin-Fang Organic Letters, 2011 , vol. 13, # 22 p. 6102 - 6105 |
|
~%
2,3-Dimethyl-4-... CAS#:37699-43-7 |
| Literature: Kohl; Sturm; Senn-Bilfinger; Simon; Kruger; Schaefer; Rainer; Figala; Klemm Journal of Medicinal Chemistry, 1992 , vol. 35, # 6 p. 1049 - 1057 |
|
~%
2,3-Dimethyl-4-... CAS#:37699-43-7 |
| Literature: Ma, Chao; Wu, Anhui; Wu, Yongqi; Ren, Xuhong; Cheng, Maosheng Archiv der Pharmazie, 2013 , vol. 346, # 12 p. 891 - 900 |
| Precursor 3 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Applications of TiCl3 as a Diagnostic Reagent for the Detection of Nitro-and N-Oxide-Containing Compounds as Potentially Mutagenic Impurities Using Ultrahigh-Performance Liquid Chromatography Coupled with High-Resolution Mass Spectrometry. Yang RS, et al.
Org. Process Res. Dev. 20(1) , 59-64, (2015)
|
|
|
Chemistry & Biology Interface. El-Moselhy TF.
Chemistry and Biology 3(2) , 123-136, (2013)
|
| 2,3-Dimethyl-4-nitropyridine N-Oxide |
| 4-Nitro-2,3-lutidine |
| 2,3-Dimethyl-4-nitropyridine-n-oxide |
| 2,3-dimethyl-4-nitro-pyridine oxide |
| MFCD00065172 |
| 4-NITRO-2,3-DIMETHYLPYRIDINE N-OXIDE |
| 4-Nitro-2,3-lutidine N-oxide |
| 2,3-Dimethyl-4-nitropyridine-N |
| 2,3-dimethyl-4-nitro-pyridin1-oxide |
| 4-Nitro-2,3-Lutidine-N-Oxide |
| 2,3-Dimethyl-4-nitropyridine 1-oxide |
| 4-nitro-2,3-dimethylpyridine 1-oxide |
| 3-DiMethyl-4-Nitropyridine N-Oxide |
| Pyridine, 2,3-dimethyl-4-nitro-, 1-oxide |