1,2-Dibromohexafluorocyclobutane structure
|
Common Name | 1,2-Dibromohexafluorocyclobutane | ||
|---|---|---|---|---|
| CAS Number | 377-40-2 | Molecular Weight | 321.84100 | |
| Density | 1.384 | Boiling Point | 93-95 | |
| Molecular Formula | C4Br2F6 | Melting Point | -31.2°C | |
| MSDS | N/A | Flash Point | 15.4ºC | |
| Name | 1,2-Dibromohexafluorocyclobutane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.384 |
|---|---|
| Boiling Point | 93-95 |
| Melting Point | -31.2°C |
| Molecular Formula | C4Br2F6 |
| Molecular Weight | 321.84100 |
| Flash Point | 15.4ºC |
| Exact Mass | 319.82700 |
| LogP | 3.39200 |
| Index of Refraction | 1.3855 |
| InChIKey | HLCPJMKKTKDOGB-UHFFFAOYSA-N |
| SMILES | FC1(F)C(F)(F)C(F)(Br)C1(F)Br |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2903890090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2903890090 |
|---|---|
| Summary | 2903890090. halogenated derivatives of cyclanic, cyclenic or cyclotherpenic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 1,2-dibromo-1,2,3,3,4,4-hexafluorocyclobutane |
| MFCD00236658 |