phenyl-(2,4,6-trimethoxyphenyl)methanone structure
|
Common Name | phenyl-(2,4,6-trimethoxyphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 3770-80-7 | Molecular Weight | 272.29600 | |
| Density | 1.136g/cm3 | Boiling Point | 444ºC at 760mmHg | |
| Molecular Formula | C16H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.9ºC | |
| Name | phenyl-(2,4,6-trimethoxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.136g/cm3 |
|---|---|
| Boiling Point | 444ºC at 760mmHg |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.29600 |
| Flash Point | 197.9ºC |
| Exact Mass | 272.10500 |
| PSA | 44.76000 |
| LogP | 2.94340 |
| Index of Refraction | 1.547 |
| InChIKey | KFZFLPQFBYUOHV-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c(C(=O)c2ccccc2)c(OC)c1 |
| HS Code | 2914509090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 8 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,4,6-Trimethoxy-benzophenon |
| 2,4,6-Trimethoxybenzophenone |
| Phenyl(2,4,6-trimethoxyphenyl)methanone |
| phenyl(2,4,6-trimethoxyphenyl)methanon |
| EINECS 223-209-0 |
| phenyl 2,4,6-trimethoxyphenyl ketone |