1-(tert-butylamino)-3-(2-methoxyphenoxy)propan-2-ol structure
|
Common Name | 1-(tert-butylamino)-3-(2-methoxyphenoxy)propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 37708-25-1 | Molecular Weight | 253.33700 | |
| Density | 1.041g/cm3 | Boiling Point | 386.7ºC at 760 mmHg | |
| Molecular Formula | C14H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.7ºC | |
| Name | 1-(tert-butylamino)-3-(2-methoxyphenoxy)propan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.041g/cm3 |
|---|---|
| Boiling Point | 386.7ºC at 760 mmHg |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.33700 |
| Flash Point | 187.7ºC |
| Exact Mass | 253.16800 |
| PSA | 50.72000 |
| LogP | 2.21390 |
| Index of Refraction | 1.507 |
| InChIKey | MFUFKDHTQHYPJS-UHFFFAOYSA-N |
| SMILES | COc1ccccc1OCC(O)CNC(C)(C)C |
| HS Code | 2922509090 |
|---|
|
~92%
1-(tert-butylam... CAS#:37708-25-1 |
| Literature: Azizi, Najmodin; Saidi, Mohammad R. Organic Letters, 2005 , vol. 7, # 17 p. 3649 - 3651 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| F3314-0169 |
| (+/-)-1-tert-butylamino-3-(2-methoxyphenoxy)propan-2-ol |
| 1-t-Butylamino-3-(o-methoxyphenoxy)-2-propanol |