2,3,6-triphenylpyridine
2,3,6-triphenylpyridine structure
|
Common Name | 2,3,6-triphenylpyridine | ||
|---|---|---|---|---|
| CAS Number | 37786-68-8 | Molecular Weight | 307.38800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H17N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3,6-triphenylpyridine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H17N |
|---|---|
| Molecular Weight | 307.38800 |
| Exact Mass | 307.13600 |
| PSA | 12.89000 |
| LogP | 6.08260 |
| InChIKey | ZLEQZRQWLZPNPW-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2ccc(-c3ccccc3)c(-c3ccccc3)n2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 0 | |
CAS#:501-65-5
CAS#:165554-70-1
CAS#:4393-21-9
CAS#:100-47-0
CAS#:536-74-3
CAS#:5731-95-3
CAS#:58337-98-7
CAS#:451-40-1
CAS#:936-59-4
CAS#:952-06-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,3,6-Triphenyl-pyridin |
| 2,3,6-triphenypyridine |
| 2,3,6-triphenyl-pyridine |
| Pyridine,2,3,6-triphenyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2,3,6-triphenylpyridine? |
| A: The English name of 2,3,6-triphenylpyridine is 2,3,6-triphenylpyridine. |
| Q: What are the upstream materials of 2,3,6-triphenylpyridine? |
| A: Related upstream materials(CAS) of 2,3,6-triphenylpyridine: 501-65-5;165554-70-1;4393-21-9;100-47-0;536-74-3;5731-95-3;58337-98-7;451-40-1;936-59-4;952-06-7. |
| Q: What is the molecular weight of 2,3,6-triphenylpyridine? |
| A: Molecular weight of 2,3,6-triphenylpyridine is 307.38800. |
| Q: What is the LogP of 2,3,6-triphenylpyridine? |
| A: LogP of 2,3,6-triphenylpyridine is 6.08260. |
| Q: What is the CAS number of 2,3,6-triphenylpyridine? |
| A: CAS number of 2,3,6-triphenylpyridine is 37786-68-8. |
| Q: What is the SMILES notation of 2,3,6-triphenylpyridine? |
| A: SMILES notation of 2,3,6-triphenylpyridine is c1ccc(-c2ccc(-c3ccccc3)c(-c3ccccc3)n2)cc1. |
| Q: What is the InChIKey of 2,3,6-triphenylpyridine? |
| A: InChIKey of 2,3,6-triphenylpyridine is ZLEQZRQWLZPNPW-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 37786-68-8? |
| A: Chinese name of 37786-68-8 is 37786-68-8. |
| Q: What English synonyms does 2,3,6-triphenylpyridine have? |
| A: English synonyms of 2,3,6-triphenylpyridine: 2,3,6-Triphenyl-pyridin, 2,3,6-triphenypyridine, 2,3,6-triphenyl-pyridine, Pyridine,2,3,6-triphenyl. |
| Q: What is the polar surface area (PSA) of 2,3,6-triphenylpyridine? |
| A: Polar surface area (PSA) of 2,3,6-triphenylpyridine is 12.89000. |