2,2,3,3,4,5,5,6,6-nonafluoromorpholine structure
|
Common Name | 2,2,3,3,4,5,5,6,6-nonafluoromorpholine | ||
|---|---|---|---|---|
| CAS Number | 378-94-9 | Molecular Weight | 249.03500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4F9NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,3,3,4,5,5,6,6-nonafluoromorpholine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C4F9NO |
|---|---|
| Molecular Weight | 249.03500 |
| Exact Mass | 248.98400 |
| PSA | 12.47000 |
| LogP | 2.51220 |
| InChIKey | BJBXQQZMELYVMD-UHFFFAOYSA-N |
| SMILES | FN1C(F)(F)C(F)(F)OC(F)(F)C1(F)F |
|
~%
2,2,3,3,4,5,5,6... CAS#:378-94-9 |
| Literature: Simmons et al. Journal of the American Chemical Society, 1957 , vol. 79, p. 3429,3430 |
| Morpholine,nonafluoro |
| Perfluormorpholin |
| Perfluor-N-fluormorpholin |
| Nonafluor-morpholin |
| F-N-Fluormorpholin |
| nonafluoromorpholine |