10-[2-(dimethylamino)propyl]acridin-9-one structure
|
Common Name | 10-[2-(dimethylamino)propyl]acridin-9-one | ||
|---|---|---|---|---|
| CAS Number | 3785-45-3 | Molecular Weight | 280.36400 | |
| Density | 1.128g/cm3 | Boiling Point | 418.6ºC at 760 mmHg | |
| Molecular Formula | C18H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.4ºC | |
| Name | 10-[2-(dimethylamino)propyl]acridin-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.128g/cm3 |
|---|---|
| Boiling Point | 418.6ºC at 760 mmHg |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.36400 |
| Flash Point | 176.4ºC |
| Exact Mass | 280.15800 |
| PSA | 25.24000 |
| LogP | 3.10480 |
| Index of Refraction | 1.595 |
| InChIKey | JGMKLAMJRHRHTI-UHFFFAOYSA-N |
| SMILES | CC(Cn1c2ccccc2c(=O)c2ccccc21)N(C)C |
| HS Code | 2933990090 |
|---|
|
~%
10-[2-(dimethyl... CAS#:3785-45-3 |
| Literature: Mallinckordt Chem.Works Patent: US2709171 , 1952 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 10-[2-(dimethylamino)propyl]acridin-9(10h)-one |
| 10-(2-dimethylamino-propyl)-10H-acridin-9-one |