1,2,3,4-cyclopentanetetracarboxylic acid
1,2,3,4-cyclopentanetetracarboxylic acid structure
|
Common Name | 1,2,3,4-cyclopentanetetracarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 3786-91-2 | Molecular Weight | 246.171 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 495.6±45.0 °C at 760 mmHg | |
| Molecular Formula | C9H10O8 | Melting Point | 192 °C | |
| MSDS | Chinese USA | Flash Point | 267.6±25.2 °C | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Cis,Cis,Cis-1,2,3,4-Cyclopentanetetracarboxylic Acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 495.6±45.0 °C at 760 mmHg |
| Melting Point | 192 °C |
| Molecular Formula | C9H10O8 |
| Molecular Weight | 246.171 |
| Flash Point | 267.6±25.2 °C |
| Exact Mass | 246.037567 |
| PSA | 149.20000 |
| LogP | -1.31 |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | WOSVXXBNNCUXMT-VERZDPOYSA-N |
| SMILES | O=C(O)C1CC(C(=O)O)C(C(=O)O)C1C(=O)O |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H311-H314-H331 |
| Precautionary Statements | P261-P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S27-S36/37/39-S45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Assays to identify small molecules inhibitory for eIF4E expression
Source: 13133
Target: N/A
External Id: 20160513eIF4E
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| cis,cis,cis-1,2,3,4-Cyclopentanetetracarboxylic acid |
| MFCD00001377 |
| 1,2,3,4-cyclopentanetetracarboxylic acid |
| cyclopentane-1,2,3,4-tetracarboxylic acid |
| EINECS 223-256-7 |
| cis,cis,cis,cis-1,2,3,4-Cyclopentanetetracarboxylic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Cis,Cis,Cis-1,2,3,4-Cyclopentanetetracarboxylic Acid? |
| A: Molecular formula of Cis,Cis,Cis-1,2,3,4-Cyclopentanetetracarboxylic Acid is C9H10O8. |
| Q: What is the safety information for Cis,Cis,Cis-1,2,3,4-Cyclopentanetetracarboxylic Acid? |
| A: Safety information for Cis,Cis,Cis-1,2,3,4-Cyclopentanetetracarboxylic Acid: S26-S27-S36/37/39-S45. |
| Q: What is the molecular weight of Cis,Cis,Cis-1,2,3,4-Cyclopentanetetracarboxylic Acid? |
| A: Molecular weight of Cis,Cis,Cis-1,2,3,4-Cyclopentanetetracarboxylic Acid is 246.171. |
| Q: What is the InChIKey of Cis,Cis,Cis-1,2,3,4-Cyclopentanetetracarboxylic Acid? |
| A: InChIKey of Cis,Cis,Cis-1,2,3,4-Cyclopentanetetracarboxylic Acid is WOSVXXBNNCUXMT-VERZDPOYSA-N. |
| Q: What is the English name of Cis,Cis,Cis-1,2,3,4-Cyclopentanetetracarboxylic Acid? |
| A: The English name of Cis,Cis,Cis-1,2,3,4-Cyclopentanetetracarboxylic Acid is Cis,Cis,Cis-1,2,3,4-Cyclopentanetetracarboxylic Acid. |
| Q: What is the CAS number of Cis,Cis,Cis-1,2,3,4-Cyclopentanetetracarboxylic Acid? |
| A: CAS number of Cis,Cis,Cis-1,2,3,4-Cyclopentanetetracarboxylic Acid is 3786-91-2. |
| Q: What is the melting point of Cis,Cis,Cis-1,2,3,4-Cyclopentanetetracarboxylic Acid? |
| A: Melting point of Cis,Cis,Cis-1,2,3,4-Cyclopentanetetracarboxylic Acid is 192 °C. |
| Q: What English synonyms does Cis,Cis,Cis-1,2,3,4-Cyclopentanetetracarboxylic Acid have? |
| A: English synonyms of Cis,Cis,Cis-1,2,3,4-Cyclopentanetetracarboxylic Acid: cis,cis,cis-1,2,3,4-Cyclopentanetetracarboxylic acid, MFCD00001377, 1,2,3,4-cyclopentanetetracarboxylic acid, cyclopentane-1,2,3,4-tetracarboxylic acid, EINECS 223-256-7, cis,cis,cis,cis-1,2,3,4-Cyclopentanetetracarboxylic acid. |
| Q: What is the SMILES notation of Cis,Cis,Cis-1,2,3,4-Cyclopentanetetracarboxylic Acid? |
| A: SMILES notation of Cis,Cis,Cis-1,2,3,4-Cyclopentanetetracarboxylic Acid is O=C(O)C1CC(C(=O)O)C(C(=O)O)C1C(=O)O. |
| Q: What is the LogP of Cis,Cis,Cis-1,2,3,4-Cyclopentanetetracarboxylic Acid? |
| A: LogP of Cis,Cis,Cis-1,2,3,4-Cyclopentanetetracarboxylic Acid is -1.31. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |