1,2,3,4-cyclopentanetetracarboxylic acid structure
|
Common Name | 1,2,3,4-cyclopentanetetracarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 3786-91-2 | Molecular Weight | 246.171 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 495.6±45.0 °C at 760 mmHg | |
| Molecular Formula | C9H10O8 | Melting Point | 192 °C | |
| MSDS | Chinese USA | Flash Point | 267.6±25.2 °C | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
| Name | Cis,Cis,Cis-1,2,3,4-Cyclopentanetetracarboxylic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 495.6±45.0 °C at 760 mmHg |
| Melting Point | 192 °C |
| Molecular Formula | C9H10O8 |
| Molecular Weight | 246.171 |
| Flash Point | 267.6±25.2 °C |
| Exact Mass | 246.037567 |
| PSA | 149.20000 |
| LogP | -1.31 |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | WOSVXXBNNCUXMT-VERZDPOYSA-N |
| SMILES | O=C(O)C1CC(C(=O)O)C(C(=O)O)C1C(=O)O |
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H311-H314-H331 |
| Precautionary Statements | P261-P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S27-S36/37/39-S45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
|
Name: Assays to identify small molecules inhibitory for eIF4E expression
Source: 13133
Target: N/A
External Id: 20160513eIF4E
|
| cis,cis,cis-1,2,3,4-Cyclopentanetetracarboxylic acid |
| MFCD00001377 |
| 1,2,3,4-cyclopentanetetracarboxylic acid |
| cyclopentane-1,2,3,4-tetracarboxylic acid |
| EINECS 223-256-7 |
| cis,cis,cis,cis-1,2,3,4-Cyclopentanetetracarboxylic acid |