1-(2-Amino-4-(trifluoromethyl)phenyl)ethanone structure
|
Common Name | 1-(2-Amino-4-(trifluoromethyl)phenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 37885-07-7 | Molecular Weight | 203.16100 | |
| Density | 1.296g/cm3 | Boiling Point | 274ºC at 760 mmHg | |
| Molecular Formula | C9H8F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 119.5ºC | |
| Name | 1-(2-Amino-4-(trifluoromethyl)phenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.296g/cm3 |
|---|---|
| Boiling Point | 274ºC at 760 mmHg |
| Molecular Formula | C9H8F3NO |
| Molecular Weight | 203.16100 |
| Flash Point | 119.5ºC |
| Exact Mass | 203.05600 |
| PSA | 43.09000 |
| LogP | 3.07140 |
| Index of Refraction | 1.492 |
| InChIKey | ALHLVWOGPMHZHJ-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(C(F)(F)F)cc1N |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922399090 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-[2-Amino-4-(trifluoromethyl)phenyl]ethanone |