3-Amino-4-methyl-2-nitrobenzoic acid structure
|
Common Name | 3-Amino-4-methyl-2-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 37901-90-9 | Molecular Weight | 196.16000 | |
| Density | 1.482g/cm3 | Boiling Point | 444.8ºC at 760 mmHg | |
| Molecular Formula | C8H8N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.8ºC | |
| Name | 2-Nitro-3-Amino-4-Methylbenzoic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.482g/cm3 |
|---|---|
| Boiling Point | 444.8ºC at 760 mmHg |
| Molecular Formula | C8H8N2O4 |
| Molecular Weight | 196.16000 |
| Flash Point | 222.8ºC |
| Exact Mass | 196.04800 |
| PSA | 109.14000 |
| LogP | 2.28800 |
| Index of Refraction | 1.658 |
| InChIKey | JLWAVVAJFWDXEF-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)O)c([N+](=O)[O-])c1N |
| HS Code | 2922499990 |
|---|
|
~84%
3-Amino-4-methy... CAS#:37901-90-9 |
| Literature: AMGEN INC. Patent: WO2007/76092 A2, 2007 ; Location in patent: Page/Page column 71 ; WO 2007/076092 A2 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 3-Amino-4-methyl-2-nitrobenzoic acid |