(2E,6E)-3,7-Dimethyl-8-oxoocta-2,6-dien-1-yl acetate structure
|
Common Name | (2E,6E)-3,7-Dimethyl-8-oxoocta-2,6-dien-1-yl acetate | ||
|---|---|---|---|---|
| CAS Number | 37905-02-5 | Molecular Weight | 210.27000 | |
| Density | 0.981±0.06 g/cm3(Predicted) | Boiling Point | 160 °C | |
| Molecular Formula | C12H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3,7-dimethyl-8-oxoocta-2,6-dienyl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.981±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 160 °C |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27000 |
| Exact Mass | 210.12600 |
| PSA | 43.37000 |
| LogP | 2.42120 |
| InChIKey | YODDEHYDMMDDCV-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC=C(C)CCC=C(C)C=O |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2915390090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| 2,6-Octadienal,8-(acetyloxy)-2,6-dimethyl-,(2E,6E) |
| (2E,6E)-3,7-dimethyl-8-oxoocta-2,6-dienyl acetate |
| acetic acid 3,7-dimethyl-8-oxo-octa-2,6-dienyl ester |
| 2,6-Octadienal,8-(acetyloxy)-2,6-dimethyl |
| (E,E)-3,3-dimethyl-1-acetoxy-2,6-octadien-8-al |
| (2E,6E)-8-acetoxy-2,6-dimethylocta-2,6-dienoic aldehyde |
| 8-Oxo-3,7-dimethyl-2(E),6(E)-octadienyl acetate |
| (2E,6E)-3,7-dimethyl-8-oxoocta-2,6-dien-1-yl acetate |