Methyl 3-formyl-6-methoxy-1H-indole-2-carboxylate structure
|
Common Name | Methyl 3-formyl-6-methoxy-1H-indole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 379260-71-6 | Molecular Weight | 233.22000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 3-formyl-6-methoxy-1h-indole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H11NO4 |
|---|---|
| Molecular Weight | 233.22000 |
| Exact Mass | 233.06900 |
| PSA | 68.39000 |
| LogP | 1.77560 |
| InChIKey | CSTAQZMFVOKNJA-UHFFFAOYSA-N |
| SMILES | COC(=O)c1[nH]c2cc(OC)ccc2c1C=O |
| HS Code | 2933990090 |
|---|
|
~92%
Methyl 3-formyl... CAS#:379260-71-6 |
| Literature: Skibo; Xing; Dorr Journal of Medicinal Chemistry, 2001 , vol. 44, # 22 p. 3545 - 3562 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 3-formyl-6-methoxyindole-2-carboxylate |