xanthonolol structure
|
Common Name | xanthonolol | ||
|---|---|---|---|---|
| CAS Number | 37933-99-6 | Molecular Weight | 327.37400 | |
| Density | 1.225g/cm3 | Boiling Point | 508.8ºC at 760mmHg | |
| Molecular Formula | C19H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.5ºC | |
| Name | 3-[2-hydroxy-3-(propan-2-ylamino)propoxy]xanthen-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.225g/cm3 |
|---|---|
| Boiling Point | 508.8ºC at 760mmHg |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.37400 |
| Flash Point | 261.5ºC |
| Exact Mass | 327.14700 |
| PSA | 71.70000 |
| LogP | 3.07480 |
| Index of Refraction | 1.591 |
| InChIKey | OLDFECRHZVIEMS-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(O)COc1ccc2c(=O)c3ccccc3oc2c1 |
|
~62%
xanthonolol CAS#:37933-99-6 |
| Literature: Liou; Teng; Ko; Lin Journal of Pharmaceutical Sciences, 1994 , vol. 83, # 3 p. 391 - 395 |
|
~%
xanthonolol CAS#:37933-99-6 |
| Literature: Liou; Teng; Ko; Lin Journal of Pharmaceutical Sciences, 1994 , vol. 83, # 3 p. 391 - 395 |
| Xanthonolol |