Benzoic acid 2,2,2-trichloroethyl ester structure
|
Common Name | Benzoic acid 2,2,2-trichloroethyl ester | ||
|---|---|---|---|---|
| CAS Number | 37934-99-9 | Molecular Weight | 253.51000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7Cl3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,2-trichloroethyl benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H7Cl3O2 |
|---|---|
| Molecular Weight | 253.51000 |
| Exact Mass | 251.95100 |
| PSA | 26.30000 |
| LogP | 3.21360 |
| InChIKey | WGXLSZQUOYSATB-UHFFFAOYSA-N |
| SMILES | O=C(OCC(Cl)(Cl)Cl)c1ccccc1 |
| HS Code | 2916310090 |
|---|
| HS Code | 2916310090 |
|---|---|
| Summary | 2916310090 other benzoic acid and its salts and esters。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| benzoic acid-(2,2,2-trichloro-ethyl ester) |
| Benzoesaeure-(2,2,2-trichlor-aethylester) |