4-(4-chlorophenyl)sulfonylbenzoic acid structure
|
Common Name | 4-(4-chlorophenyl)sulfonylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 37940-65-1 | Molecular Weight | 296.72600 | |
| Density | 1.466g/cm3 | Boiling Point | 506.3ºC at 760 mmHg | |
| Molecular Formula | C13H9ClO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260ºC | |
| Name | 4-(4-chlorophenyl)sulfonylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.466g/cm3 |
|---|---|
| Boiling Point | 506.3ºC at 760 mmHg |
| Molecular Formula | C13H9ClO4S |
| Molecular Weight | 296.72600 |
| Flash Point | 260ºC |
| Exact Mass | 295.99100 |
| PSA | 79.82000 |
| LogP | 3.95180 |
| Index of Refraction | 1.623 |
| InChIKey | MIVYLPYNSKNBPW-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| HS Code | 2916399090 |
|---|
|
~%
4-(4-chlorophen... CAS#:37940-65-1 |
| Literature: Boyarskii; Zhesko; Lanina Russian Journal of Applied Chemistry, 2005 , vol. 78, # 11 p. 1844 - 1848 |
|
~%
4-(4-chlorophen... CAS#:37940-65-1 |
| Literature: Buehler; Masters Journal of Organic Chemistry, 1939 , vol. 4, p. 262,264 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-Chlor-4'-carboxy-diphenylsulfon |
| 4-Chlor-4'-carboxy-diphenylsulphon |
| 4-Chloro-4'-carboxydiphenyl sulfone |