1-chloro-4-(4-methylphenyl)sulfonyl-benzene structure
|
Common Name | 1-chloro-4-(4-methylphenyl)sulfonyl-benzene | ||
|---|---|---|---|---|
| CAS Number | 5184-71-4 | Molecular Weight | 266.74300 | |
| Density | 1.294g/cm3 | Boiling Point | 411.1ºC at 760 mmHg | |
| Molecular Formula | C13H11ClO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.4ºC | |
| Name | 1-(4-chlorophenyl)sulfonyl-4-methylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.294g/cm3 |
|---|---|
| Boiling Point | 411.1ºC at 760 mmHg |
| Molecular Formula | C13H11ClO2S |
| Molecular Weight | 266.74300 |
| Flash Point | 202.4ºC |
| Exact Mass | 266.01700 |
| PSA | 42.52000 |
| LogP | 4.56200 |
| Index of Refraction | 1.592 |
| InChIKey | OFGLBHMUHZRKFN-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| HS Code | 2904100000 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 4-chlorophenyl 4-methylphenyl sulfone |