9-ethyl-3H-purine-2,6-dione structure
|
Common Name | 9-ethyl-3H-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 37962-92-8 | Molecular Weight | 180.16400 | |
| Density | 1.68g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H8N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9-ethyl-3H-purine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.68g/cm3 |
|---|---|
| Molecular Formula | C7H8N4O2 |
| Molecular Weight | 180.16400 |
| Exact Mass | 180.06500 |
| PSA | 83.54000 |
| Index of Refraction | 1.768 |
| InChIKey | DGYYSFOHNFAMAB-UHFFFAOYSA-N |
| SMILES | CCn1cnc2c(=O)[nH]c(=O)[nH]c21 |
| HS Code | 2933990090 |
|---|
|
~%
9-ethyl-3H-puri... CAS#:37962-92-8 |
| Literature: Koppel; Robins Journal of the American Chemical Society, 1958 , vol. 80, p. 2751,2753 |
|
~%
9-ethyl-3H-puri... CAS#:37962-92-8 |
| Literature: Boehringer and Soehne Patent: DE120437 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 6, p. 1180 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 9-ethyl-3,9-dihydro-1h-purine-2,6-dione |
| 9-Aethyl-3,9-dihydro-purin-2,6-dion |
| 9-ethyl-3,9-dihydro-purine-2,6-dione |
| 9-Aethyl-xanthin |