2-Phosphonobutane-1,2,4-tricarboxylic acid structure
|
Common Name | 2-Phosphonobutane-1,2,4-tricarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 37971-36-1 | Molecular Weight | 270.13100 | |
| Density | 1.25 (50% aq.) | Boiling Point | 545.2ºC at 760 mmHg | |
| Molecular Formula | C7H11O9P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.5ºC | |
| Name | 2-Phosphonobutane-1,2,4-Tricarboxylic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25 (50% aq.) |
|---|---|
| Boiling Point | 545.2ºC at 760 mmHg |
| Molecular Formula | C7H11O9P |
| Molecular Weight | 270.13100 |
| Flash Point | 283.5ºC |
| Exact Mass | 270.01400 |
| PSA | 179.24000 |
| Index of Refraction | 1.579 |
| InChIKey | SZHQPBJEOCHCKM-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(CC(=O)O)(C(=O)O)P(=O)(O)O |
| Storage condition | 2~8℃ |
| Hazard Codes | Xi:Irritant |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | S26-S45 |
| RIDADR | UN 3265 |
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| MFCD01940753 |
| 2-Phosphonobutane -1,2,4-tricarboxylic acid |
| EINECS 253-733-5 |
| 2-Phosphonobutane-1,2,4-tricarboxylic Acid |
| 3-Carboxy-3-phosphonohexanedioic acid |