2-(5-fluoronaphthalene-1-carbonyl)benzoic acid
Modify Date: 2025-09-24 00:18:04
2-(5-fluoronaphthalene-1-carbonyl)benzoic acid structure
|
Common Name | 2-(5-fluoronaphthalene-1-carbonyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 3799-78-8 | Molecular Weight | 294.27700 | |
| Density | 1.347g/cm3 | Boiling Point | 528.4ºC at 760 mmHg | |
| Molecular Formula | C18H11FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.4ºC | |
| Name | 2-(5-fluoronaphthalene-1-carbonyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.347g/cm3 |
|---|---|
| Boiling Point | 528.4ºC at 760 mmHg |
| Molecular Formula | C18H11FO3 |
| Molecular Weight | 294.27700 |
| Flash Point | 273.4ºC |
| Exact Mass | 294.06900 |
| PSA | 54.37000 |
| LogP | 3.90810 |
| Index of Refraction | 1.661 |
| InChIKey | AIHPNMHUYIBOFX-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1C(=O)c1cccc2c(F)cccc12 |
| HS Code | 2916399090 |
|---|
|
~%
2-(5-fluoronaph... CAS#:3799-78-8 |
| Literature: Newman et al. Journal of Organic Chemistry, 1959 , vol. 24, p. 509,511 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-(5-fluoro-[1]naphthoyl)-benzoic acid |
| o-(5-Fluor-1-naphthoyl)-benzoesaeure |
| 2-(5-Fluor-[1]naphthoyl)-benzoesaeure |
| 2-[(5-fluoronaphthalen-1-yl)carbonyl]benzoic acid |