1,1,1,2,2,6,6,7,7,7-Decafluoroheptane-3,5-dione structure
|
Common Name | 1,1,1,2,2,6,6,7,7,7-Decafluoroheptane-3,5-dione | ||
|---|---|---|---|---|
| CAS Number | 38007-33-9 | Molecular Weight | 308.07400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H2F10O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,1,2,2,6,6,7,7,7-Decafluoroheptane-3,5-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H2F10O2 |
|---|---|
| Molecular Weight | 308.07400 |
| Exact Mass | 307.99000 |
| PSA | 34.14000 |
| LogP | 2.90990 |
| InChIKey | GYQLGOFXHBMNRM-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| HS Code | 2914700090 |
|---|
|
~%
1,1,1,2,2,6,6,7... CAS#:38007-33-9 |
| Literature: Merck and Co., Inc. Patent: US3962262 A1, 1976 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1,1,1,2,2,6,6,7,7,7,-Decafluoroheptan-3,5-dione |
| 3,5-Heptanedione,1,1,1,2,2,6,6,7,7,7-decafluoro |
| 1,1,1,2,2,6,6,7,7,7-decafluoro-heptane-3,5-dione |
| 1,1,1,2,2,6,6,7,7,7-decafluoro-3,5-heptadione |
| 1,1,1,2,2,6,6,7,7,7-decafluoro-3,5-heptanedione |