Perfluorododecyl iodide structure
|
Common Name | Perfluorododecyl iodide | ||
|---|---|---|---|---|
| CAS Number | 307-60-8 | Molecular Weight | 745.99300 | |
| Density | 1.951g/cm3 | Boiling Point | 108-110ºC (18 mmHg) | |
| Molecular Formula | C12F25I | Melting Point | 99-101ºC | |
| MSDS | Chinese USA | Flash Point | 110.8ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-pentacosafluoro-12-iodododecane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.951g/cm3 |
|---|---|
| Boiling Point | 108-110ºC (18 mmHg) |
| Melting Point | 99-101ºC |
| Molecular Formula | C12F25I |
| Molecular Weight | 745.99300 |
| Flash Point | 110.8ºC |
| Exact Mass | 745.86500 |
| LogP | 8.92950 |
| Index of Refraction | 1.312 |
| InChIKey | WBYCUETVRCXUPE-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)I |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~6%
Perfluorododecy... CAS#:307-60-8
Detail
|
| Literature: Journal of Fluorine Chemistry, , vol. 88, # 2 p. 153 - 168 |
|
~%
Perfluorododecy... CAS#:307-60-8
Detail
|
| Literature: EP1380557 A1, ; Page 7; 8 ; |
|
~%
Perfluorododecy... CAS#:307-60-8
Detail
|
| Literature: US2011/28768 A1, ; Page/Page column 3-4 ; |
|
~%
Perfluorododecy... CAS#:307-60-8 |
| Literature: Journal of the Chemical Society, , p. 3761,3766 |
| Precursor 3 | |
|---|---|
| DownStream 6 | |
|
The in vitro estrogenic activities of polyfluorinated iodine alkanes.
Environ. Health Perspect. 120(1) , 119-25, (2012) Polyfluorinated iodine alkanes (PFIs) are important intermediates in the synthesis of organic fluoride products. Recently, PFIs have been detected in fluoropolymers as residual raw materials, as well ... |
| 1,1,2,2-Tetrahydroperfluorododecyl iodide |
| EINECS 206-205-3 |
| Dodecane,1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-pentacosafluoro-12-iodo |
| Pentacosafluoro-1-iodododecane |
| 1-Iodoperfluorododecane |
| Perfluorododecyl iodide |
| MFCD00001066 |
| Pentacosafluor-1-jod-dodecan |
| perfluorododec-1-yl iodide |