(2E)-3-(2-Chlorophenyl)-1-(4-methylphenyl)-2-propen-1-one
(2E)-3-(2-Chlorophenyl)-1-(4-methylphenyl)-2-propen-1-one structure
|
Common Name | (2E)-3-(2-Chlorophenyl)-1-(4-methylphenyl)-2-propen-1-one | ||
|---|---|---|---|---|
| CAS Number | 38018-63-2 | Molecular Weight | 256.72700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2E)-3-(2-Chlorophenyl)-1-(4-methylphenyl)-2-propen-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H13ClO |
|---|---|
| Molecular Weight | 256.72700 |
| Exact Mass | 256.06500 |
| PSA | 17.07000 |
| LogP | 4.54450 |
| InChIKey | QXADQJCWOIEYOS-ZHACJKMWSA-N |
| SMILES | Cc1ccc(C(=O)C=Cc2ccccc2Cl)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~71%
(2E)-3-(2-Chlor... CAS#:38018-63-2 |
| Literature: Rao, Maddali L.N.; Venkatesh, Varadhachari; Jadhav, Deepak N. Journal of Organometallic Chemistry, 2008 , vol. 693, # 15 p. 2494 - 2498 |
|
~80%
(2E)-3-(2-Chlor... CAS#:38018-63-2 |
| Literature: Huang, Danfeng; Wang, Jin-Xian; Hu, Yulai; Zhang, Yumei; Tang, Jing Synthetic Communications, 2002 , vol. 32, # 7 p. 971 - 979 |
|
~%
(2E)-3-(2-Chlor... CAS#:38018-63-2 |
| Literature: Davey; Tivey Journal of the Chemical Society, 1958 , p. 1230,1235 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-chloro-4'-methyl-trans-chalcone |
| 2-Chlor-4'-methyl-trans-chalkon |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (2E)-3-(2-Chlorophenyl)-1-(4-methylphenyl)-2-propen-1-one? |
| A: CAS number of (2E)-3-(2-Chlorophenyl)-1-(4-methylphenyl)-2-propen-1-one is 38018-63-2. |
| Q: What is the molecular formula of (2E)-3-(2-Chlorophenyl)-1-(4-methylphenyl)-2-propen-1-one? |
| A: Molecular formula of (2E)-3-(2-Chlorophenyl)-1-(4-methylphenyl)-2-propen-1-one is C16H13ClO. |
| Q: What is the SMILES notation of (2E)-3-(2-Chlorophenyl)-1-(4-methylphenyl)-2-propen-1-one? |
| A: SMILES notation of (2E)-3-(2-Chlorophenyl)-1-(4-methylphenyl)-2-propen-1-one is Cc1ccc(C(=O)C=Cc2ccccc2Cl)cc1. |
| Q: What English synonyms does (2E)-3-(2-Chlorophenyl)-1-(4-methylphenyl)-2-propen-1-one have? |
| A: English synonyms of (2E)-3-(2-Chlorophenyl)-1-(4-methylphenyl)-2-propen-1-one: 2-chloro-4'-methyl-trans-chalcone, 2-Chlor-4'-methyl-trans-chalkon. |
| Q: What is the molecular weight of (2E)-3-(2-Chlorophenyl)-1-(4-methylphenyl)-2-propen-1-one? |
| A: Molecular weight of (2E)-3-(2-Chlorophenyl)-1-(4-methylphenyl)-2-propen-1-one is 256.72700. |
| Q: What is the Chinese name of 38018-63-2? |
| A: Chinese name of 38018-63-2 is 38018-63-2. |
| Q: What is the English name of (2E)-3-(2-Chlorophenyl)-1-(4-methylphenyl)-2-propen-1-one? |
| A: The English name of (2E)-3-(2-Chlorophenyl)-1-(4-methylphenyl)-2-propen-1-one is (2E)-3-(2-Chlorophenyl)-1-(4-methylphenyl)-2-propen-1-one. |
| Q: What is the InChIKey of (2E)-3-(2-Chlorophenyl)-1-(4-methylphenyl)-2-propen-1-one? |
| A: InChIKey of (2E)-3-(2-Chlorophenyl)-1-(4-methylphenyl)-2-propen-1-one is QXADQJCWOIEYOS-ZHACJKMWSA-N. |
| Q: What is the LogP of (2E)-3-(2-Chlorophenyl)-1-(4-methylphenyl)-2-propen-1-one? |
| A: LogP of (2E)-3-(2-Chlorophenyl)-1-(4-methylphenyl)-2-propen-1-one is 4.54450. |
| Q: What is the polar surface area (PSA) of (2E)-3-(2-Chlorophenyl)-1-(4-methylphenyl)-2-propen-1-one? |
| A: Polar surface area (PSA) of (2E)-3-(2-Chlorophenyl)-1-(4-methylphenyl)-2-propen-1-one is 17.07000. |