Tris(4-methylphenyl)bismuthine structure
|
Common Name | Tris(4-methylphenyl)bismuthine | ||
|---|---|---|---|---|
| CAS Number | 5142-75-6 | Molecular Weight | 482.372 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H21Bi | Melting Point | 119ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Tris(4-Methylphenyl)Bismuthine |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 119ºC |
|---|---|
| Molecular Formula | C21H21Bi |
| Molecular Weight | 482.372 |
| Exact Mass | 482.144714 |
| LogP | 5.38560 |
| InChIKey | XIECNHSGPKDTNW-UHFFFAOYSA-N |
| SMILES | Cc1ccc([Bi](c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| HS Code | 2931900090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Tri-p-tolylbisMuthine |
| tris(4-methylphenyl)bismuthane |
| Tris(4-methylphenyl)bismuthine |
| Tris(p-tolyl)bismuthine |