Ethyl 2-methyl-6-(trifluoromethyl)nicotinate
Modify Date: 2026-08-06 13:44:25
Ethyl 2-methyl-6-(trifluoromethyl)nicotinate structure
|
Common Name | Ethyl 2-methyl-6-(trifluoromethyl)nicotinate | ||
|---|---|---|---|---|
| CAS Number | 380355-65-7 | Molecular Weight | 233.18700 | |
| Density | 1.248g/cm3 | Boiling Point | 229.133ºC at 760 mmHg | |
| Molecular Formula | C10H10F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 92.377ºC | |
| Name | Ethyl 2-methyl-6-(trifluoromethyl)nicotinate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.248g/cm3 |
|---|---|
| Boiling Point | 229.133ºC at 760 mmHg |
| Molecular Formula | C10H10F3NO2 |
| Molecular Weight | 233.18700 |
| Flash Point | 92.377ºC |
| Exact Mass | 233.06600 |
| PSA | 39.19000 |
| LogP | 2.58550 |
| Index of Refraction | 1.454 |
| InChIKey | VWUMOTRXCZMICA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(C(F)(F)F)nc1C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
|
~80%
Ethyl 2-methyl-... CAS#:380355-65-7 |
| Literature: WO2012/61926 A1, ; Page/Page column 39 ; WO 2012/061926 A1 |
|
~71%
Ethyl 2-methyl-... CAS#:380355-65-7 |
| Literature: WO2006/59103 A2, ; Page/Page column 29 ; |
|
~73%
Ethyl 2-methyl-... CAS#:380355-65-7 |
| Literature: WO2006/59103 A2, ; Page/Page column 30 ; |
CAS#:681260-50-4| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ethyl 2-Methyl-6-(trifluoromethyl)nicotinate |
| ethyl 2-methyl-6-(trifluoromethyl)pyridine-3-carboxylate |