WAY-605650 structure
|
Common Name | WAY-605650 | ||
|---|---|---|---|---|
| CAS Number | 380543-06-6 | Molecular Weight | 347.8 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 553.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C18H18ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288.3±30.1 °C | |
Use of WAY-605650Inhibitors of bacterial type III secretion system |
| Name | WAY-605650 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 553.0±50.0 °C at 760 mmHg |
| Molecular Formula | C18H18ClNO4 |
| Molecular Weight | 347.8 |
| Flash Point | 288.3±30.1 °C |
| Exact Mass | 347.092438 |
| LogP | 4.12 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | FJONZIFFQLDHDQ-UHFFFAOYSA-N |
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)NCc1ccc2c(c1)OCO2 |
| N-(1,3-Benzodioxol-5-ylmethyl)-2-(4-chlorophenoxy)-2-methylpropanamide |
| Propanamide, N-(1,3-benzodioxol-5-ylmethyl)-2-(4-chlorophenoxy)-2-methyl- |